3,4-dichlorohexafluoro-1-butene
3,4-dichlorohexafluoro-1-butene structure
|
Common Name | 3,4-dichlorohexafluoro-1-butene | ||
|---|---|---|---|---|
| CAS Number | 357-21-1 | Molecular Weight | 232.93900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4Cl2F6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,4-dichlorohexafluoro-1-butene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C4Cl2F6 |
|---|---|
| Molecular Weight | 232.93900 |
| Exact Mass | 231.92800 |
| LogP | 3.80020 |
| InChIKey | KWXXMLHQBFNLOR-UHFFFAOYSA-N |
| SMILES | FC(F)=C(F)C(F)(Cl)C(F)(F)Cl |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 5 | |
CAS#:79-38-9
CAS#:79-47-0
CAS#:356-18-3
CAS#:685-63-2
CAS#:375-27-9This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3,4-dichloro-hexafluoro-but-1-ene |
| 3,4-Dichlor-hexafluor-but-1-en |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 3,4-dichlorohexafluoro-1-butene? |
| A: Molecular weight of 3,4-dichlorohexafluoro-1-butene is 232.93900. |
| Q: What are the downstream products of 3,4-dichlorohexafluoro-1-butene? |
| A: Related downstream products(CAS) of 3,4-dichlorohexafluoro-1-butene: 79-38-9;79-47-0;356-18-3;685-63-2;375-27-9. |
| Q: What is the Chinese name of 357-21-1? |
| A: Chinese name of 357-21-1 is 357-21-1. |
| Q: What is the English name of 3,4-dichlorohexafluoro-1-butene? |
| A: The English name of 3,4-dichlorohexafluoro-1-butene is 3,4-dichlorohexafluoro-1-butene. |
| Q: What is the SMILES notation of 3,4-dichlorohexafluoro-1-butene? |
| A: SMILES notation of 3,4-dichlorohexafluoro-1-butene is FC(F)=C(F)C(F)(Cl)C(F)(F)Cl. |
| Q: What is the InChIKey of 3,4-dichlorohexafluoro-1-butene? |
| A: InChIKey of 3,4-dichlorohexafluoro-1-butene is KWXXMLHQBFNLOR-UHFFFAOYSA-N. |
| Q: What is the LogP of 3,4-dichlorohexafluoro-1-butene? |
| A: LogP of 3,4-dichlorohexafluoro-1-butene is 3.80020. |
| Q: What is the molecular formula of 3,4-dichlorohexafluoro-1-butene? |
| A: Molecular formula of 3,4-dichlorohexafluoro-1-butene is C4Cl2F6. |
| Q: What English synonyms does 3,4-dichlorohexafluoro-1-butene have? |
| A: English synonyms of 3,4-dichlorohexafluoro-1-butene: 3,4-dichloro-hexafluoro-but-1-ene, 3,4-Dichlor-hexafluor-but-1-en. |
| Q: What is the CAS number of 3,4-dichlorohexafluoro-1-butene? |
| A: CAS number of 3,4-dichlorohexafluoro-1-butene is 357-21-1. |