4,4-Dichloro-1,1,2,3,3,4-hexafluoro-1-butene structure
|
Common Name | 4,4-Dichloro-1,1,2,3,3,4-hexafluoro-1-butene | ||
|---|---|---|---|---|
| CAS Number | 357-24-4 | Molecular Weight | 232.93900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4Cl2F6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,4-dichloro-1,1,2,3,3,4-hexafluorobut-1-ene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C4Cl2F6 |
|---|---|
| Molecular Weight | 232.93900 |
| Exact Mass | 231.92800 |
| LogP | 3.80020 |
| InChIKey | OZAWCRZCYBVMBW-UHFFFAOYSA-N |
| SMILES | FC(F)=C(F)C(F)(F)C(F)(Cl)Cl |
| HS Code | 2903799090 |
|---|
|
~%
4,4-Dichloro-1,... CAS#:357-24-4 |
| Literature: Kellogg Co. Patent: US2742510 , 1955 ; |
|
~%
4,4-Dichloro-1,... CAS#:357-24-4 |
| Literature: Haszeldine Journal of the Chemical Society, 1955 , p. 4291,4300 |
|
~%
4,4-Dichloro-1,... CAS#:357-24-4 |
| Literature: Haszeldine Journal of the Chemical Society, 1955 , p. 4291,4300 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2903799090 |
|---|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 4,4-dichlorohexafluorobutene-1 |
| 1-Butene,4,4-dichlorohexafluoro |
| 1-Butene,4,4-dichloro-1,1,2,3,3,4-hexafluoro |
| 4,4-dichloro-hexafluoro-but-1-ene |
| 4,4-Dichlor-hexafluor-but-1-en |
| 4,4-Dichlorhexafluor-1-buten |