1,1,1,2,2-pentafluoro-4-methyl-pentan-3-ol
Modify Date: 2026-09-21 17:18:05
1,1,1,2,2-pentafluoro-4-methyl-pentan-3-ol structure
|
Common Name | 1,1,1,2,2-pentafluoro-4-methyl-pentan-3-ol | ||
|---|---|---|---|---|
| CAS Number | 357-27-7 | Molecular Weight | 192.12700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H9F5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,1,1,2,2-pentafluoro-4-methyl-pentan-3-ol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H9F5O |
|---|---|
| Molecular Weight | 192.12700 |
| Exact Mass | 192.05700 |
| PSA | 20.23000 |
| LogP | 2.20090 |
| InChIKey | OCLHTLTWUKWEJZ-UHFFFAOYSA-N |
| SMILES | CC(C)C(O)C(F)(F)C(F)(F)F |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,1,1,2,2-Pentafluor-4-methyl-pentan-3-ol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 1,1,1,2,2-pentafluoro-4-methyl-pentan-3-ol? |
| A: Polar surface area (PSA) of 1,1,1,2,2-pentafluoro-4-methyl-pentan-3-ol is 20.23000. |
| Q: What is the LogP of 1,1,1,2,2-pentafluoro-4-methyl-pentan-3-ol? |
| A: LogP of 1,1,1,2,2-pentafluoro-4-methyl-pentan-3-ol is 2.20090. |
| Q: What English synonyms does 1,1,1,2,2-pentafluoro-4-methyl-pentan-3-ol have? |
| A: English synonyms of 1,1,1,2,2-pentafluoro-4-methyl-pentan-3-ol: 1,1,1,2,2-Pentafluor-4-methyl-pentan-3-ol. |
| Q: What is the CAS number of 1,1,1,2,2-pentafluoro-4-methyl-pentan-3-ol? |
| A: CAS number of 1,1,1,2,2-pentafluoro-4-methyl-pentan-3-ol is 357-27-7. |
| Q: What is the InChIKey of 1,1,1,2,2-pentafluoro-4-methyl-pentan-3-ol? |
| A: InChIKey of 1,1,1,2,2-pentafluoro-4-methyl-pentan-3-ol is OCLHTLTWUKWEJZ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1,1,1,2,2-pentafluoro-4-methyl-pentan-3-ol? |
| A: SMILES notation of 1,1,1,2,2-pentafluoro-4-methyl-pentan-3-ol is CC(C)C(O)C(F)(F)C(F)(F)F. |
| Q: What is the Chinese name of 357-27-7? |
| A: Chinese name of 357-27-7 is 357-27-7. |
| Q: What is the molecular formula of 1,1,1,2,2-pentafluoro-4-methyl-pentan-3-ol? |
| A: Molecular formula of 1,1,1,2,2-pentafluoro-4-methyl-pentan-3-ol is C6H9F5O. |
| Q: What is the English name of 1,1,1,2,2-pentafluoro-4-methyl-pentan-3-ol? |
| A: The English name of 1,1,1,2,2-pentafluoro-4-methyl-pentan-3-ol is 1,1,1,2,2-pentafluoro-4-methyl-pentan-3-ol. |
| Q: What is the molecular weight of 1,1,1,2,2-pentafluoro-4-methyl-pentan-3-ol? |
| A: Molecular weight of 1,1,1,2,2-pentafluoro-4-methyl-pentan-3-ol is 192.12700. |