1,1,1,2,2-pentafluoro-4-methyl-pentan-3-one structure
|
Common Name | 1,1,1,2,2-pentafluoro-4-methyl-pentan-3-one | ||
|---|---|---|---|---|
| CAS Number | 357-28-8 | Molecular Weight | 190.11100 | |
| Density | 1.247g/cm3 | Boiling Point | 87.8ºC at 760mmHg | |
| Molecular Formula | C6H7F5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 23.1ºC | |
| Name | 1,1,1,2,2-pentafluoro-4-methylpentan-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.247g/cm3 |
|---|---|
| Boiling Point | 87.8ºC at 760mmHg |
| Molecular Formula | C6H7F5O |
| Molecular Weight | 190.11100 |
| Flash Point | 23.1ºC |
| Exact Mass | 190.04200 |
| PSA | 17.07000 |
| LogP | 2.40910 |
| Index of Refraction | 1.324 |
| InChIKey | FCVMAXTWQAFQPW-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)C(F)(F)C(F)(F)F |
| HS Code | 2914700090 |
|---|
|
~%
1,1,1,2,2-penta... CAS#:357-28-8 |
| Literature: Dishart; Levine Journal of the American Chemical Society, 1956 , vol. 78, p. 2268 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1,1,1,2,2-PENTAFLUORO-4-METHYL-PENTAN-3-ONE |
| 1,1,1,2,2-Pentafluor-4-methyl-pentan-3-on |
| Pentafluoraethyl-isopropyl-keton |