(2-chloro-1,1,2,2-tetrafluoro-ethyl)-benzene
(2-chloro-1,1,2,2-tetrafluoro-ethyl)-benzene structure
|
Common Name | (2-chloro-1,1,2,2-tetrafluoro-ethyl)-benzene | ||
|---|---|---|---|---|
| CAS Number | 357-41-5 | Molecular Weight | 212.57200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H5ClF4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2-chloro-1,1,2,2-tetrafluoro-ethyl)-benzene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H5ClF4 |
|---|---|
| Molecular Weight | 212.57200 |
| Exact Mass | 212.00200 |
| LogP | 3.61000 |
| InChIKey | PFDHYABRKXGCGO-UHFFFAOYSA-N |
| SMILES | FC(F)(Cl)C(F)(F)c1ccccc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2903999090 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (2-chloro-1,1,2,2-tetrafluoro-ethyl)-benzene? |
| A: Molecular formula of (2-chloro-1,1,2,2-tetrafluoro-ethyl)-benzene is C8H5ClF4. |
| Q: What is the SMILES notation of (2-chloro-1,1,2,2-tetrafluoro-ethyl)-benzene? |
| A: SMILES notation of (2-chloro-1,1,2,2-tetrafluoro-ethyl)-benzene is FC(F)(Cl)C(F)(F)c1ccccc1. |
| Q: What is the LogP of (2-chloro-1,1,2,2-tetrafluoro-ethyl)-benzene? |
| A: LogP of (2-chloro-1,1,2,2-tetrafluoro-ethyl)-benzene is 3.61000. |
| Q: What is the molecular weight of (2-chloro-1,1,2,2-tetrafluoro-ethyl)-benzene? |
| A: Molecular weight of (2-chloro-1,1,2,2-tetrafluoro-ethyl)-benzene is 212.57200. |
| Q: What is the English name of (2-chloro-1,1,2,2-tetrafluoro-ethyl)-benzene? |
| A: The English name of (2-chloro-1,1,2,2-tetrafluoro-ethyl)-benzene is (2-chloro-1,1,2,2-tetrafluoro-ethyl)-benzene. |
| Q: What is the Chinese name of 357-41-5? |
| A: Chinese name of 357-41-5 is 357-41-5. |
| Q: What is the InChIKey of (2-chloro-1,1,2,2-tetrafluoro-ethyl)-benzene? |
| A: InChIKey of (2-chloro-1,1,2,2-tetrafluoro-ethyl)-benzene is PFDHYABRKXGCGO-UHFFFAOYSA-N. |
| Q: What is the CAS number of (2-chloro-1,1,2,2-tetrafluoro-ethyl)-benzene? |
| A: CAS number of (2-chloro-1,1,2,2-tetrafluoro-ethyl)-benzene is 357-41-5. |