Sodium 1,5,5-triethyl-2,6-dioxo-1,2,5,6-tetrahydropyrimidin-4-olate
Modify Date: 2026-07-08 15:58:04
Sodium 1,5,5-triethyl-2,6-dioxo-1,2,5,6-tetrahydropyrimidin-4-olate structure
|
Common Name | Sodium 1,5,5-triethyl-2,6-dioxo-1,2,5,6-tetrahydropyrimidin-4-olate | ||
|---|---|---|---|---|
| CAS Number | 357-69-7 | Molecular Weight | 234.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H15N2NaO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Sodium 1,5,5-triethyl-2,6-dioxo-1,2,5,6-tetrahydropyrimidin-4-olate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H15N2NaO3 |
|---|---|
| Molecular Weight | 234.23 |
| InChIKey | YJMIMZCVYFWXAC-UHFFFAOYSA-M |
| SMILES | CCN1C(=O)[N-]C(=O)C(CC)(CC)C1=O.[Na+] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Sodium 1,5,5-triethyl-2,6-dioxo-1,2,5,6-tetrahydropyrimidin-4-olate? |
| A: Molecular weight of Sodium 1,5,5-triethyl-2,6-dioxo-1,2,5,6-tetrahydropyrimidin-4-olate is 234.23. |
| Q: What is the English name of Sodium 1,5,5-triethyl-2,6-dioxo-1,2,5,6-tetrahydropyrimidin-4-olate? |
| A: The English name of Sodium 1,5,5-triethyl-2,6-dioxo-1,2,5,6-tetrahydropyrimidin-4-olate is Sodium 1,5,5-triethyl-2,6-dioxo-1,2,5,6-tetrahydropyrimidin-4-olate. |
| Q: What is the SMILES notation of Sodium 1,5,5-triethyl-2,6-dioxo-1,2,5,6-tetrahydropyrimidin-4-olate? |
| A: SMILES notation of Sodium 1,5,5-triethyl-2,6-dioxo-1,2,5,6-tetrahydropyrimidin-4-olate is CCN1C(=O)[N-]C(=O)C(CC)(CC)C1=O.[Na+]. |
| Q: What is the molecular formula of Sodium 1,5,5-triethyl-2,6-dioxo-1,2,5,6-tetrahydropyrimidin-4-olate? |
| A: Molecular formula of Sodium 1,5,5-triethyl-2,6-dioxo-1,2,5,6-tetrahydropyrimidin-4-olate is C10H15N2NaO3. |
| Q: What is the Chinese name of 357-69-7? |
| A: Chinese name of 357-69-7 is 357-69-7. |
| Q: What is the CAS number of Sodium 1,5,5-triethyl-2,6-dioxo-1,2,5,6-tetrahydropyrimidin-4-olate? |
| A: CAS number of Sodium 1,5,5-triethyl-2,6-dioxo-1,2,5,6-tetrahydropyrimidin-4-olate is 357-69-7. |
| Q: What is the InChIKey of Sodium 1,5,5-triethyl-2,6-dioxo-1,2,5,6-tetrahydropyrimidin-4-olate? |
| A: InChIKey of Sodium 1,5,5-triethyl-2,6-dioxo-1,2,5,6-tetrahydropyrimidin-4-olate is YJMIMZCVYFWXAC-UHFFFAOYSA-M. |