1,5-Di-H-hexafluoro-1,4-cyclohexadiene
1,5-Di-H-hexafluoro-1,4-cyclohexadiene structure
|
Common Name | 1,5-Di-H-hexafluoro-1,4-cyclohexadiene | ||
|---|---|---|---|---|
| CAS Number | 357-85-7 | Molecular Weight | 188.07000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H2F6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,5-Di-H-hexafluoro-1,4-cyclohexadiene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H2F6 |
|---|---|
| Molecular Weight | 188.07000 |
| Exact Mass | 188.00600 |
| LogP | 2.97740 |
| InChIKey | OEIIWRMJUZGUIY-UHFFFAOYSA-N |
| SMILES | FC1=CC(F)(F)C=C(F)C1(F)F |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:1514-85-8
CAS#:2367-82-0
CAS#:363-72-4This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1H,5H-Hexafluor-cyclohexadien-(1.4) |
| 1,3,3,5,6,6-Hexafluor-cyclohexa-1,4-dien |
| 1,3,3,5,6,6-hexafluoro-cyclohexa-1,4-diene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1,5-Di-H-hexafluoro-1,4-cyclohexadiene? |
| A: InChIKey of 1,5-Di-H-hexafluoro-1,4-cyclohexadiene is OEIIWRMJUZGUIY-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1,5-Di-H-hexafluoro-1,4-cyclohexadiene? |
| A: CAS number of 1,5-Di-H-hexafluoro-1,4-cyclohexadiene is 357-85-7. |
| Q: What is the SMILES notation of 1,5-Di-H-hexafluoro-1,4-cyclohexadiene? |
| A: SMILES notation of 1,5-Di-H-hexafluoro-1,4-cyclohexadiene is FC1=CC(F)(F)C=C(F)C1(F)F. |
| Q: What are the downstream products of 1,5-Di-H-hexafluoro-1,4-cyclohexadiene? |
| A: Related downstream products(CAS) of 1,5-Di-H-hexafluoro-1,4-cyclohexadiene: 1514-85-8;2367-82-0;363-72-4. |
| Q: What English synonyms does 1,5-Di-H-hexafluoro-1,4-cyclohexadiene have? |
| A: English synonyms of 1,5-Di-H-hexafluoro-1,4-cyclohexadiene: 1H,5H-Hexafluor-cyclohexadien-(1.4), 1,3,3,5,6,6-Hexafluor-cyclohexa-1,4-dien, 1,3,3,5,6,6-hexafluoro-cyclohexa-1,4-diene. |
| Q: What is the LogP of 1,5-Di-H-hexafluoro-1,4-cyclohexadiene? |
| A: LogP of 1,5-Di-H-hexafluoro-1,4-cyclohexadiene is 2.97740. |
| Q: What is the English name of 1,5-Di-H-hexafluoro-1,4-cyclohexadiene? |
| A: The English name of 1,5-Di-H-hexafluoro-1,4-cyclohexadiene is 1,5-Di-H-hexafluoro-1,4-cyclohexadiene. |
| Q: What is the molecular weight of 1,5-Di-H-hexafluoro-1,4-cyclohexadiene? |
| A: Molecular weight of 1,5-Di-H-hexafluoro-1,4-cyclohexadiene is 188.07000. |
| Q: What is the molecular formula of 1,5-Di-H-hexafluoro-1,4-cyclohexadiene? |
| A: Molecular formula of 1,5-Di-H-hexafluoro-1,4-cyclohexadiene is C6H2F6. |
| Q: What is the Chinese name of 357-85-7? |
| A: Chinese name of 357-85-7 is 357-85-7. |