2-(1-Chloro-2,2,2-trifluoroethyl)-2-(trifluoromethyl)-1,3-dioxolane
Modify Date: 2025-09-15 11:56:25
2-(1-Chloro-2,2,2-trifluoroethyl)-2-(trifluoromethyl)-1,3-dioxolane structure
|
Common Name | 2-(1-Chloro-2,2,2-trifluoroethyl)-2-(trifluoromethyl)-1,3-dioxolane | ||
|---|---|---|---|---|
| CAS Number | 357-90-4 | Molecular Weight | 258.54 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H5ClF6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(1-Chloro-2,2,2-trifluoroethyl)-2-(trifluoromethyl)-1,3-dioxolane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H5ClF6O2 |
|---|---|
| Molecular Weight | 258.54 |
| InChIKey | BARHKLZOVFGWDR-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(Cl)C1(C(F)(F)F)OCCO1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-(1-Chloro-2,2,2-trifluoroethyl)-2-(trifluoromethyl)-1,3-dioxolane? |
| A: CAS number of 2-(1-Chloro-2,2,2-trifluoroethyl)-2-(trifluoromethyl)-1,3-dioxolane is 357-90-4. |
| Q: What is the English name of 2-(1-Chloro-2,2,2-trifluoroethyl)-2-(trifluoromethyl)-1,3-dioxolane? |
| A: The English name of 2-(1-Chloro-2,2,2-trifluoroethyl)-2-(trifluoromethyl)-1,3-dioxolane is 2-(1-Chloro-2,2,2-trifluoroethyl)-2-(trifluoromethyl)-1,3-dioxolane. |
| Q: What is the InChIKey of 2-(1-Chloro-2,2,2-trifluoroethyl)-2-(trifluoromethyl)-1,3-dioxolane? |
| A: InChIKey of 2-(1-Chloro-2,2,2-trifluoroethyl)-2-(trifluoromethyl)-1,3-dioxolane is BARHKLZOVFGWDR-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-(1-Chloro-2,2,2-trifluoroethyl)-2-(trifluoromethyl)-1,3-dioxolane? |
| A: Molecular formula of 2-(1-Chloro-2,2,2-trifluoroethyl)-2-(trifluoromethyl)-1,3-dioxolane is C6H5ClF6O2. |
| Q: What is the SMILES notation of 2-(1-Chloro-2,2,2-trifluoroethyl)-2-(trifluoromethyl)-1,3-dioxolane? |
| A: SMILES notation of 2-(1-Chloro-2,2,2-trifluoroethyl)-2-(trifluoromethyl)-1,3-dioxolane is FC(F)(F)C(Cl)C1(C(F)(F)F)OCCO1. |
| Q: What is the molecular weight of 2-(1-Chloro-2,2,2-trifluoroethyl)-2-(trifluoromethyl)-1,3-dioxolane? |
| A: Molecular weight of 2-(1-Chloro-2,2,2-trifluoroethyl)-2-(trifluoromethyl)-1,3-dioxolane is 258.54. |
| Q: What is the Chinese name of 357-90-4? |
| A: Chinese name of 357-90-4 is 357-90-4. |