2,2-dichloro-N-(2-hydroxyethyl)-N-[(2-methylsulfonylphenyl)methyl]acetamide structure
|
Common Name | 2,2-dichloro-N-(2-hydroxyethyl)-N-[(2-methylsulfonylphenyl)methyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 3570-99-8 | Molecular Weight | 340.22300 | |
| Density | 1.426g/cm3 | Boiling Point | 553.4ºC at 760 mmHg | |
| Molecular Formula | C12H15Cl2NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 288.5ºC | |
| Name | 2,2-dichloro-N-(2-hydroxyethyl)-N-[(2-methylsulfonylphenyl)methyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.426g/cm3 |
|---|---|
| Boiling Point | 553.4ºC at 760 mmHg |
| Molecular Formula | C12H15Cl2NO4S |
| Molecular Weight | 340.22300 |
| Flash Point | 288.5ºC |
| Exact Mass | 339.01000 |
| PSA | 83.06000 |
| LogP | 2.29550 |
| Index of Refraction | 1.572 |
| InChIKey | JVGZJJWLGNLVKX-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1ccccc1CN(CCO)C(=O)C(Cl)Cl |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| ls-8870 |
| b 6421 |