2-amino-n-(2,3-dimethylphenyl)benzamide structure
|
Common Name | 2-amino-n-(2,3-dimethylphenyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 35703-71-0 | Molecular Weight | 240.30000 | |
| Density | 1.182g/cm3 | Boiling Point | 338.3ºC at 760 mmHg | |
| Molecular Formula | C15H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.4ºC | |
| Name | 2-amino-n-(2,3-dimethylphenyl)benzamide |
|---|
| Density | 1.182g/cm3 |
|---|---|
| Boiling Point | 338.3ºC at 760 mmHg |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.30000 |
| Flash Point | 158.4ºC |
| Exact Mass | 240.12600 |
| PSA | 55.12000 |
| LogP | 3.79210 |
| Index of Refraction | 1.656 |
| InChIKey | HPTLYBZCELMYHK-UHFFFAOYSA-N |
| SMILES | Cc1cccc(NC(=O)c2ccccc2N)c1C |
| HS Code | 2924299090 |
|---|
|
~56%
2-amino-n-(2,3-... CAS#:35703-71-0 |
| Literature: Clark; Lin; Sansom Journal of Medicinal Chemistry, 1986 , vol. 29, # 8 p. 1534 - 1537 |
|
~%
2-amino-n-(2,3-... CAS#:35703-71-0 |
| Literature: Clark; Lin; Sansom Journal of Medicinal Chemistry, 1986 , vol. 29, # 8 p. 1534 - 1537 |
|
~%
2-amino-n-(2,3-... CAS#:35703-71-0 |
| Literature: Clark; Lin; Sansom Journal of Medicinal Chemistry, 1986 , vol. 29, # 8 p. 1534 - 1537 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |