2,2-dichloro-N-(2-hydroxyethyl)-N-[(4-methylphenyl)methyl]acetamide
Modify Date: 2025-09-04 07:41:22
![2,2-dichloro-N-(2-hydroxyethyl)-N-[(4-methylphenyl)methyl]acetamide Structure](https://image.chemsrc.com/caspic/432/3571-00-4.png)
2,2-dichloro-N-(2-hydroxyethyl)-N-[(4-methylphenyl)methyl]acetamide structure
|
Common Name | 2,2-dichloro-N-(2-hydroxyethyl)-N-[(4-methylphenyl)methyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 3571-00-4 | Molecular Weight | 276.15900 | |
| Density | 1.296g/cm3 | Boiling Point | 412.2ºC at 760 mmHg | |
| Molecular Formula | C12H15Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.1ºC | |
| Name | 2,2-dichloro-N-(2-hydroxyethyl)-N-[(4-methylphenyl)methyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.296g/cm3 |
|---|---|
| Boiling Point | 412.2ºC at 760 mmHg |
| Molecular Formula | C12H15Cl2NO2 |
| Molecular Weight | 276.15900 |
| Flash Point | 203.1ºC |
| Exact Mass | 275.04800 |
| PSA | 40.54000 |
| LogP | 2.11960 |
| Index of Refraction | 1.565 |
| InChIKey | LEXACAWUAADPEA-UHFFFAOYSA-N |
| SMILES | Cc1ccc(CN(CCO)C(=O)C(Cl)Cl)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
2,2-dichloro-N-... CAS#:3571-00-4 |
| Literature: Kidd,D.A.A.; Wright,D.E. Journal of the Chemical Society, 1962 , p. 1420 - 1427 |
![Ethanol,2-[[(4-methylphenyl)methyl]amino]- structure](https://image.chemsrc.com/caspic/167/40171-87-7.png)
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| m &ac1l56f4 |
| ls-8869 |
| b 5297 |