bis(1-phenylethyl) benzene-1,2-dicarboxylate structure
|
Common Name | bis(1-phenylethyl) benzene-1,2-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 35754-90-6 | Molecular Weight | 374.42900 | |
| Density | 1.165g/cm3 | Boiling Point | 476ºC at 760 mmHg | |
| Molecular Formula | C24H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.3ºC | |
| Name | bis(1-phenylethyl) benzene-1,2-dicarboxylate |
|---|
| Density | 1.165g/cm3 |
|---|---|
| Boiling Point | 476ºC at 760 mmHg |
| Molecular Formula | C24H22O4 |
| Molecular Weight | 374.42900 |
| Flash Point | 233.3ºC |
| Exact Mass | 374.15200 |
| PSA | 52.60000 |
| LogP | 5.52260 |
| Index of Refraction | 1.587 |
| InChIKey | RZHCBUNQWKVGAW-UHFFFAOYSA-N |
| SMILES | CC(OC(=O)c1ccccc1C(=O)OC(C)c1ccccc1)c1ccccc1 |
|
~72%
bis(1-phenyleth... CAS#:35754-90-6 |
| Literature: Valizadeh; Khalili Journal of the Iranian Chemical Society, 2012 , vol. 9, # 4 p. 529 - 534 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |