2,2-dichloro-N-[(3,4-dimethoxyphenyl)methyl]-N-(2-hydroxyethyl)acetamide structure
|
Common Name | 2,2-dichloro-N-[(3,4-dimethoxyphenyl)methyl]-N-(2-hydroxyethyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 3576-63-4 | Molecular Weight | 322.18400 | |
| Density | 1.316g/cm3 | Boiling Point | 456.4ºC at 760 mmHg | |
| Molecular Formula | C13H17Cl2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.8ºC | |
Summary: 2,2-Dichloro-N-[(3,4-dimethoxyphenyl)methyl]-N-(2-hydroxyethyl)acetamide (CAS number: 3576-63-4), molecular formula C13H17Cl2NO4, molecular weight 322.18400. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,2-dichloro-N-[(3,4-dimethoxyphenyl)methyl]-N-(2-hydroxyethyl)acetamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.316g/cm3 |
|---|---|
| Boiling Point | 456.4ºC at 760 mmHg |
| Molecular Formula | C13H17Cl2NO4 |
| Molecular Weight | 322.18400 |
| Flash Point | 229.8ºC |
| Exact Mass | 321.05300 |
| PSA | 59.00000 |
| LogP | 1.82840 |
| Index of Refraction | 1.55 |
| InChIKey | GXQYCMHQLMYTTM-UHFFFAOYSA-N |
| SMILES | COc1ccc(CN(CCO)C(=O)C(Cl)Cl)cc1OC |
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2,2-dichloro-N-... CAS#:3576-63-4 |
| Literature: Surrey Journal of the American Chemical Society, 1954 , vol. 76, p. 2214 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| ls-8876 |
| b 5540 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 2,2-dichloro-N-[(3,4-dimethoxyphenyl)methyl]-N-(2-hydroxyethyl)acetamide? |
| A: Polar surface area (PSA) of 2,2-dichloro-N-[(3,4-dimethoxyphenyl)methyl]-N-(2-hydroxyethyl)acetamide is 59.00000. |
| Q: What is the English name of 2,2-dichloro-N-[(3,4-dimethoxyphenyl)methyl]-N-(2-hydroxyethyl)acetamide? |
| A: The English name of 2,2-dichloro-N-[(3,4-dimethoxyphenyl)methyl]-N-(2-hydroxyethyl)acetamide is 2,2-dichloro-N-[(3,4-dimethoxyphenyl)methyl]-N-(2-hydroxyethyl)acetamide. |
| Q: What is the SMILES notation of 2,2-dichloro-N-[(3,4-dimethoxyphenyl)methyl]-N-(2-hydroxyethyl)acetamide? |
| A: SMILES notation of 2,2-dichloro-N-[(3,4-dimethoxyphenyl)methyl]-N-(2-hydroxyethyl)acetamide is COc1ccc(CN(CCO)C(=O)C(Cl)Cl)cc1OC. |
| Q: What is the Chinese name of 3576-63-4? |
| A: Chinese name of 3576-63-4 is 3576-63-4. |
| Q: What English synonyms does 2,2-dichloro-N-[(3,4-dimethoxyphenyl)methyl]-N-(2-hydroxyethyl)acetamide have? |
| A: English synonyms of 2,2-dichloro-N-[(3,4-dimethoxyphenyl)methyl]-N-(2-hydroxyethyl)acetamide: ls-8876, b 5540. |
| Q: What is the molecular formula of 2,2-dichloro-N-[(3,4-dimethoxyphenyl)methyl]-N-(2-hydroxyethyl)acetamide? |
| A: Molecular formula of 2,2-dichloro-N-[(3,4-dimethoxyphenyl)methyl]-N-(2-hydroxyethyl)acetamide is C13H17Cl2NO4. |
| Q: What is the CAS number of 2,2-dichloro-N-[(3,4-dimethoxyphenyl)methyl]-N-(2-hydroxyethyl)acetamide? |
| A: CAS number of 2,2-dichloro-N-[(3,4-dimethoxyphenyl)methyl]-N-(2-hydroxyethyl)acetamide is 3576-63-4. |
| Q: What is the LogP of 2,2-dichloro-N-[(3,4-dimethoxyphenyl)methyl]-N-(2-hydroxyethyl)acetamide? |
| A: LogP of 2,2-dichloro-N-[(3,4-dimethoxyphenyl)methyl]-N-(2-hydroxyethyl)acetamide is 1.82840. |
| Q: What is the boiling point of 2,2-dichloro-N-[(3,4-dimethoxyphenyl)methyl]-N-(2-hydroxyethyl)acetamide? |
| A: Boiling point of 2,2-dichloro-N-[(3,4-dimethoxyphenyl)methyl]-N-(2-hydroxyethyl)acetamide is 456.4ºC at 760 mmHg. |
| Q: What is the InChIKey of 2,2-dichloro-N-[(3,4-dimethoxyphenyl)methyl]-N-(2-hydroxyethyl)acetamide? |
| A: InChIKey of 2,2-dichloro-N-[(3,4-dimethoxyphenyl)methyl]-N-(2-hydroxyethyl)acetamide is GXQYCMHQLMYTTM-UHFFFAOYSA-N. |