cis-2-(3-chlorobenzoyl)cyclohexane-1-carboxylic acid structure
|
Common Name | cis-2-(3-chlorobenzoyl)cyclohexane-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 357980-62-2 | Molecular Weight | 266.72000 | |
| Density | 1.284g/cm3 | Boiling Point | 447.2ºC at 760 mmHg | |
| Molecular Formula | C14H15ClO3 | Melting Point | 135-139ºC | |
| MSDS | N/A | Flash Point | 224.3ºC | |
| Name | cis-2-(3-chlorobenzoyl)cyclohexane-1-carboxylic acid |
|---|
| Density | 1.284g/cm3 |
|---|---|
| Boiling Point | 447.2ºC at 760 mmHg |
| Melting Point | 135-139ºC |
| Molecular Formula | C14H15ClO3 |
| Molecular Weight | 266.72000 |
| Flash Point | 224.3ºC |
| Exact Mass | 266.07100 |
| PSA | 54.37000 |
| LogP | 3.41370 |
| Index of Refraction | 1.571 |
| InChIKey | NSALXIWKYUKRPY-NWDGAFQWSA-N |
| SMILES | O=C(O)C1CCCCC1C(=O)c1cccc(Cl)c1 |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |