4-(Dimethylamino)-2,2-diisopropylbutyramide
Modify Date: 2024-01-05 12:40:24
4-(Dimethylamino)-2,2-diisopropylbutyramide structure
|
Common Name | 4-(Dimethylamino)-2,2-diisopropylbutyramide | ||
|---|---|---|---|---|
| CAS Number | 3582-38-5 | Molecular Weight | 214.34800 | |
| Density | 0.91g/cm3 | Boiling Point | 328.4ºC at 760 mmHg | |
| Molecular Formula | C12H26N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.4ºC | |
| Name | 2-[2-(dimethylamino)ethyl]-3-methyl-2-propan-2-ylbutanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.91g/cm3 |
|---|---|
| Boiling Point | 328.4ºC at 760 mmHg |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.34800 |
| Flash Point | 152.4ºC |
| Exact Mass | 214.20500 |
| PSA | 47.32000 |
| LogP | 2.87150 |
| Index of Refraction | 1.462 |
| InChIKey | BXDZEWAIMFHWQR-UHFFFAOYSA-N |
| SMILES | CC(C)C(CCN(C)C)(C(N)=O)C(C)C |
| HS Code | 2924199090 |
|---|
|
~%
4-(Dimethylamin... CAS#:3582-38-5 |
| Literature: Pala; Casadio; Bruzzese; Crescenzi; Marazzi-Uberti Journal of medicinal chemistry, 1965 , vol. 8, # 5 p. 698 - 700 |
|
~%
4-(Dimethylamin... CAS#:3582-38-5 |
| Literature: Pala; Casadio; Bruzzese; Crescenzi; Marazzi-Uberti Journal of medicinal chemistry, 1965 , vol. 8, # 5 p. 698 - 700 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-(2-dimethylaminoethyl)-3-methyl-2-propan-2-ylbutanamide |
| Butyramide,2,2,-diisopropyl-4-dimethylamino |
| BUTYRAMIDE,2-(2-DIMETHYLAMINOETHYL)-2-ISOPROPYL-3-METHYL |