α-[2-(Dimethylamino)ethyl]-2-naphthaleneacetonitrile structure
|
Common Name | α-[2-(Dimethylamino)ethyl]-2-naphthaleneacetonitrile | ||
|---|---|---|---|---|
| CAS Number | 3582-41-0 | Molecular Weight | 238.32800 | |
| Density | 1.065g/cm3 | Boiling Point | 391.6ºC at 760 mmHg | |
| Molecular Formula | C16H18N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.1ºC | |
| Name | 4-(dimethylamino)-2-naphthalen-2-ylbutanenitrile |
|---|
| Density | 1.065g/cm3 |
|---|---|
| Boiling Point | 391.6ºC at 760 mmHg |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.32800 |
| Flash Point | 168.1ºC |
| Exact Mass | 238.14700 |
| PSA | 27.03000 |
| LogP | 3.39868 |
| Index of Refraction | 1.592 |
| InChIKey | QEDVOUKKGFBBBD-UHFFFAOYSA-N |
| SMILES | CN(C)CCC(C#N)c1ccc2ccccc2c1 |
| HS Code | 2926909090 |
|---|
|
~%
α-[2-(Dimethyla... CAS#:3582-41-0 |
| Literature: Pala; Casadio; Bruzzese; Crescenzi; Marazzi-Uberti Journal of medicinal chemistry, 1965 , vol. 8, # 5 p. 698 - 700 |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |