[2-(1-phenylpropan-2-yl)hydrazinyl]methanesulfonic acid
Modify Date: 2025-10-08 06:55:03
![[2-(1-phenylpropan-2-yl)hydrazinyl]methanesulfonic acid Structure](https://image.chemsrc.com/caspic/201/3583-81-1.png)
[2-(1-phenylpropan-2-yl)hydrazinyl]methanesulfonic acid structure
|
Common Name | [2-(1-phenylpropan-2-yl)hydrazinyl]methanesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 3583-81-1 | Molecular Weight | 244.31100 | |
| Density | 1.273g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H16N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [2-(1-phenylpropan-2-yl)hydrazinyl]methanesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.273g/cm3 |
|---|---|
| Molecular Formula | C10H16N2O3S |
| Molecular Weight | 244.31100 |
| Exact Mass | 244.08800 |
| PSA | 86.81000 |
| LogP | 2.41970 |
| Index of Refraction | 1.569 |
| InChIKey | STLDQUNGUABJPD-UHFFFAOYSA-N |
| SMILES | CC(Cc1ccccc1)NNCS(=O)(=O)O |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| usaf la-16 |