(2-(1-methyl-2-phenylethyl)hydrazine-1,1-diyl)dimethanesulfonic acid structure
|
Common Name | (2-(1-methyl-2-phenylethyl)hydrazine-1,1-diyl)dimethanesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 3583-82-2 | Molecular Weight | 361.39000 | |
| Density | 1.502g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H18N2NaO6S2+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(1-phenylpropan-2-ylamino)-(sulfomethyl)amino]methanesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.502g/cm3 |
|---|---|
| Molecular Formula | C11H18N2NaO6S2+ |
| Molecular Weight | 361.39000 |
| Exact Mass | 361.05000 |
| PSA | 140.77000 |
| LogP | 2.66730 |
| Index of Refraction | 1.61 |
| InChIKey | MYWFEIUSQKFJPJ-UHFFFAOYSA-N |
| SMILES | CC(Cc1ccccc1)NN(CS(=O)(=O)O)CS(=O)(=O)O |
| HS Code | 2921499090 |
|---|
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| [(1-methyl-2-phenyl-ethyl)-hydrazine-N,N-diyl]-bis-methanesulfonic acid,disodium-salt |
| [2-(1-methyl-2-phenylethyl)hydrazine-1,1-diyl]dimethanesulfonic acid |
| [(1-Methyl-2-phenyl-aethyl)-hydrazin-N,N-diyl]-bis-methansulfonsaeure,Dinatrium-Salz |