[3,4-dibenzoyloxy-5-(3,5-dioxo-9-thia-2,4,7-triazabicyclo[4.3.0]nona-7,10-dien-2-yl)oxolan-2-yl]methyl benzoate structure
|
Common Name | [3,4-dibenzoyloxy-5-(3,5-dioxo-9-thia-2,4,7-triazabicyclo[4.3.0]nona-7,10-dien-2-yl)oxolan-2-yl]methyl benzoate | ||
|---|---|---|---|---|
| CAS Number | 35867-92-6 | Molecular Weight | 613.59400 | |
| Density | 1.53g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C31H23N3O9S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2E)-2-(dimethylaminomethylidene)-3H-inden-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.53g/cm3 |
|---|---|
| Molecular Formula | C31H23N3O9S |
| Molecular Weight | 613.59400 |
| Exact Mass | 613.11600 |
| PSA | 184.12000 |
| LogP | 3.35190 |
| Index of Refraction | 1.696 |
| InChIKey | ZMECLRDADXQQLE-UHFFFAOYSA-N |
| SMILES | O=C(OCC1OC(n2c(=O)[nH]c(=O)c3ncsc32)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1)c1ccccc1 |
|
~%
[3,4-dibenzoylo... CAS#:35867-92-6 |
| Literature: Schmidt; Townsend The Journal of organic chemistry, 1975 , vol. 40, # 17 p. 2476 - 2481 |
| 4-(trinitromethyl)anisole |
| Benzene,1-methoxy-4-(trinitromethyl) |