3-[5-(3-carbamimidoylphenoxy)pentoxy]benzenecarboximidamide structure
|
Common Name | 3-[5-(3-carbamimidoylphenoxy)pentoxy]benzenecarboximidamide | ||
|---|---|---|---|---|
| CAS Number | 35872-76-5 | Molecular Weight | 340.41900 | |
| Density | 1.2g/cm3 | Boiling Point | 545.2ºC at 760 mmHg | |
| Molecular Formula | C19H24N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 283.5ºC | |
| Name | 3-[5-(3-carbamimidoylphenoxy)pentoxy]benzenecarboximidamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 545.2ºC at 760 mmHg |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.41900 |
| Flash Point | 283.5ºC |
| Exact Mass | 340.19000 |
| PSA | 118.20000 |
| LogP | 4.48290 |
| Index of Refraction | 1.593 |
| InChIKey | PASMXCHSIJZQBM-UHFFFAOYSA-N |
| SMILES | N=C(N)c1cccc(OCCCCCOc2cccc(C(=N)N)c2)c1 |
|
~%
3-[5-(3-carbami... CAS#:35872-76-5 |
| Literature: Tidwell; Jones; Geratz; Ohemeng; Cory; Hall Journal of Medicinal Chemistry, 1990 , vol. 33, # 4 p. 1252 - 1257 |
|
~%
3-[5-(3-carbami... CAS#:35872-76-5 |
| Literature: Tidwell; Jones; Geratz; Ohemeng; Cory; Hall Journal of Medicinal Chemistry, 1990 , vol. 33, # 4 p. 1252 - 1257 |
|
~%
3-[5-(3-carbami... CAS#:35872-76-5 |
| Literature: Tidwell; Jones; Geratz; Ohemeng; Cory; Hall Journal of Medicinal Chemistry, 1990 , vol. 33, # 4 p. 1252 - 1257 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| m-Pentamidine |
| 1.5-Bis-(3-carbamimidoyl-phenoxy)-pentan |
| Benzenecarboximidamide,3,3'-(1,5-pentanediylbis(oxy))bis |
| 3,3'-(1,5-Pentanediylbis(oxy))bis-benzenecarboximidamide |
| 1,5-Di(3-amidinophenoxy)pentane |
| 1,5-bis(benzamidine-3-oxy)pentane |
| 3,3'-Pentandiyldioxy-bis-benzamidin |
| 3,3'-pentanediyldioxy-bis-benzamidine |