Apocynol A structure
|
Common Name | Apocynol A | ||
|---|---|---|---|---|
| CAS Number | 358721-33-2 | Molecular Weight | 224.30 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 377.1±42.0 °C at 760 mmHg | |
| Molecular Formula | C13H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.0±24.4 °C | |
Use of Apocynol AApocynol A is a sesquiterpenoid compound[1]. |
| Name | 5-[(2E)-2-Buten-1-yl]-2-isopropyl-4-{[2'-(1H-tetrazol-5-yl)-4-bip henylyl]methyl}-2,4-dihydro-3H-1,2,4-triazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Description | Apocynol A is a sesquiterpenoid compound[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 377.1±42.0 °C at 760 mmHg |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 |
| Flash Point | 196.0±24.4 °C |
| Exact Mass | 224.141251 |
| PSA | 57.53000 |
| LogP | 1.21 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.557 |
| InChIKey | NSPUEQDFCJBNBF-UHFFFAOYSA-N |
| SMILES | CC(O)C=CC1C(CO)=CC(=O)CC1(C)C |
| 4-[(1E,3R)-3-Hydroxy-1-buten-1-yl]-3-(hydroxymethyl)-5,5-dimethyl-2-cyclohexen-1-one |
| (4R)-4-[(1E,3R)-3-Hydroxy-1-buten-1-yl]-3-(hydroxymethyl)-5,5-dimethyl-2-cyclohexen-1-one |
| 2-Cyclohexen-1-one, 4-[(1E,3R)-3-hydroxy-1-buten-1-yl]-3-(hydroxymethyl)-5,5-dimethyl- |
| 2-Cyclohexen-1-one, 4-[(1E,3R)-3-hydroxy-1-buten-1-yl]-3-(hydroxymethyl)-5,5-dimethyl-, (4R)- |