8-Pentyltheophyline structure
|
Common Name | 8-Pentyltheophyline | ||
|---|---|---|---|---|
| CAS Number | 35873-41-7 | Molecular Weight | 250.29700 | |
| Density | 1.219g/cm3 | Boiling Point | 474.8ºC at 760 mmHg | |
| Molecular Formula | C12H18N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241ºC | |
| Name | 1,3-dimethyl-8-pentyl-7H-purine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.219g/cm3 |
|---|---|
| Boiling Point | 474.8ºC at 760 mmHg |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.29700 |
| Flash Point | 241ºC |
| Exact Mass | 250.14300 |
| PSA | 72.68000 |
| LogP | 0.69300 |
| Index of Refraction | 1.562 |
| InChIKey | KRQCFJVRGKISQO-UHFFFAOYSA-N |
| SMILES | CCCCCc1nc2c([nH]1)c(=O)n(C)c(=O)n2C |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,7-Dihydro-1,3-dimethyl-8-pentyl-1H-purine-2,6-dione |
| Xanthine,1,3-dimethyl-8-pentyl |
| 8-Pentyl-theophyllin |
| 1,3-dimethyl-8-pentyl-3,7-dihydro-1h-purine-2,6-dione |
| 1,3-dimethyl-8-pentyl-3,7(9)-dihydro-purine-2,6-dione |
| 8-n-Pentyl-theophyllin |
| 8-Pentyltheophylline |
| Theophylline,8-pentyl |