3,7-Dihydro-8-(4-hydroxybutyl)-1,3-dimethyl-1H-purine-2,6-dione structure
|
Common Name | 3,7-Dihydro-8-(4-hydroxybutyl)-1,3-dimethyl-1H-purine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 35873-44-0 | Molecular Weight | 252.27000 | |
| Density | 1.354g/cm3 | Boiling Point | 541.3ºC at 760 mmHg | |
| Molecular Formula | C11H16N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.2ºC | |
| Name | 8-(4-hydroxybutyl)-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.354g/cm3 |
|---|---|
| Boiling Point | 541.3ºC at 760 mmHg |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27000 |
| Flash Point | 281.2ºC |
| Exact Mass | 252.12200 |
| PSA | 92.91000 |
| Index of Refraction | 1.597 |
| InChIKey | NIAMBTSPHJKHDH-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2[nH]c(CCCCO)nc2n(C)c1=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Xanthine,1,3-dimethyl-8-(4-hydroxybutyl) |
| 8-(4-Hydroxybutyl)theophylline |
| 8-(4-hydroxybutyl)-1,3-dimethyl-3,7-dihydro-1h-purine-2,6-dione |
| 8-(4-Hydroxybutyl)theophyllin |
| Theophylline,8-(4-hydroxybutyl) |
| 8-(4-hydroxy-butyl)-1,3-dimethyl-3,7(9)-dihydro-purine-2,6-dione |