4-[(3,4-Dichlorophenyl)sulfonyl]aniline structure
|
Common Name | 4-[(3,4-Dichlorophenyl)sulfonyl]aniline | ||
|---|---|---|---|---|
| CAS Number | 35881-07-3 | Molecular Weight | 302.17600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9Cl2NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(3,4-dichlorophenyl)sulfonylaniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H9Cl2NO2S |
|---|---|
| Molecular Weight | 302.17600 |
| Exact Mass | 300.97300 |
| PSA | 68.54000 |
| LogP | 5.07040 |
| InChIKey | XOCMFQGNBIWFAK-UHFFFAOYSA-N |
| SMILES | Nc1ccc(S(=O)(=O)c2ccc(Cl)c(Cl)c2)cc1 |
| HS Code | 2921420090 |
|---|
|
~%
4-[(3,4-Dichlor... CAS#:35881-07-3 |
| Literature: Popoff; Engle; Whitaker; Singhal Journal of medicinal chemistry, 1971 , vol. 14, # 12 p. 1166 - 1169 |
|
~%
4-[(3,4-Dichlor... CAS#:35881-07-3 |
| Literature: Popoff; Engle; Whitaker; Singhal Journal of medicinal chemistry, 1971 , vol. 14, # 12 p. 1166 - 1169 |
|
~%
4-[(3,4-Dichlor... CAS#:35881-07-3 |
| Literature: Popoff; Engle; Whitaker; Singhal Journal of medicinal chemistry, 1971 , vol. 14, # 12 p. 1166 - 1169 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-[(3,4-Dichlorophenyl)sulfonyl]aniline |
| p-(3,4-Dichlorophenylsulfonyl)aniline |
| Benzenamine,4-[(3,4-dichlorophenyl)sulfonyl] |
| 4-Amino-3',4'-dichlorodiphenyl sulfone |
| 4-Aminophenyl-3.4-dichlorphenylsulfon |