3-(4-Biphenylyl)propanoic acid structure
|
Common Name | 3-(4-Biphenylyl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 35888-99-4 | Molecular Weight | 226.270 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 400.4±24.0 °C at 760 mmHg | |
| Molecular Formula | C15H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 297.2±18.0 °C | |
| Name | 3-(4-phenylphenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 400.4±24.0 °C at 760 mmHg |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.270 |
| Flash Point | 297.2±18.0 °C |
| Exact Mass | 226.099380 |
| PSA | 37.30000 |
| LogP | 3.60 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | MVFHRQWYCXYYMU-UHFFFAOYSA-N |
| SMILES | O=C(O)CCc1ccc(-c2ccccc2)cc1 |
| HS Code | 2916399090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: Agonist activity at human FFA1 stably expressed in CHO cells assessed as intracellula...
Source: ChEMBL
Target: Free fatty acid receptor 1
External Id: CHEMBL5386039
|
|
Name: Agonist activity at human FFA1 stably expressed in CHO cells assessed as efficacy by ...
Source: ChEMBL
Target: Free fatty acid receptor 1
External Id: CHEMBL5386038
|
| 2(4-Biphenyl)propionic acid |
| 3-(4-Biphenyl)propionic acid |
| Biphenyl-4-propanoic acid |
| 3-(1,1'-biphenyl-4-yl)propanoic acid |
| 3-(4-Biphenylyl)propanoic acid |
| (1,1'-Biphenyl)-4-propanoic acid |
| 3-([1,1'-biphenyl]-4-yl)propionic acid |
| [1,1'-Biphenyl]-4-propanoic acid |
| 3-(4-Biphenyl)propanoic acid |
| 3-(4-biphenylyl)-propanoic acid |
| 3-(Biphenyl-4-yl)propanoic acid |
| 2(para-biphenyl)propionic acid |
| 3-(4-biphenylyl)propionic acid |