2-chloro-6-nitro-N-phenylaniline
Modify Date: 2025-08-26 14:45:29
2-chloro-6-nitro-N-phenylaniline structure
|
Common Name | 2-chloro-6-nitro-N-phenylaniline | ||
|---|---|---|---|---|
| CAS Number | 35892-17-2 | Molecular Weight | 248.66500 | |
| Density | 1.387g/cm3 | Boiling Point | 347.1ºC at 760mmHg | |
| Molecular Formula | C12H9ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.7ºC | |
| Name | 2-chloro-6-nitro-N-phenylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.387g/cm3 |
|---|---|
| Boiling Point | 347.1ºC at 760mmHg |
| Molecular Formula | C12H9ClN2O2 |
| Molecular Weight | 248.66500 |
| Flash Point | 163.7ºC |
| Exact Mass | 248.03500 |
| PSA | 57.85000 |
| LogP | 4.58800 |
| Index of Refraction | 1.671 |
| InChIKey | KCIOLUSHFMDLKF-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(Cl)c1Nc1ccccc1 |
| HS Code | 2921440000 |
|---|
|
~99%
2-chloro-6-nitr... CAS#:35892-17-2 |
| Literature: Heald, Robert; Price, Stephen; Safina, Brian; Savy, Pascal Pierre Alexandre; Seward, Eileen Mary; Sutherlin, Daniel P.; Waszkowycz, Bohdan Patent: US2012/202785 A1, 2012 ; Location in patent: Page/Page column 127 ; |
|
~%
2-chloro-6-nitr... CAS#:35892-17-2 |
| Literature: Borodkin Zhurnal Prikladnoi Khimii (Sankt-Peterburg, Russian Federation), 1948 , vol. 21, p. 987,988 Chem.Abstr., 1949 , p. 6175 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921440000 |
|---|---|
| Summary | 2921440000. diphenylamine and its derivatives; salts thereof. VAT:17.0%. Tax rebate rate:17.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (2-Chlor-6-nitro-phenyl)-phenyl-amin |
| Benzenamine,2-chloro-6-nitro-N-phenyl |
| Diphenylamine,2-chloro-6-nitro-(5CI) |
| (2-chloro-6-nitrophenyl)phenylamine |
| EINECS 252-779-3 |
| 2-Phenylamino-3-chloronitrobenzene |