chloro-bis(trifluoromethyl)arsane
chloro-bis(trifluoromethyl)arsane structure
|
Common Name | chloro-bis(trifluoromethyl)arsane | ||
|---|---|---|---|---|
| CAS Number | 359-53-5 | Molecular Weight | 248.38600 | |
| Density | N/A | Boiling Point | 60.9ºC at 760 mmHg | |
| Molecular Formula | C2AsClF6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | chloro-bis(trifluoromethyl)arsane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 60.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C2AsClF6 |
| Molecular Weight | 248.38600 |
| Exact Mass | 247.88100 |
| LogP | 3.25950 |
| InChIKey | IPCCWPDCSYLYMS-UHFFFAOYSA-N |
| SMILES | FC(F)(F)[As](Cl)C(F)(F)F |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 4 | |
CAS#:7647-01-0
CAS#:461-91-6
CAS#:5185-67-1
CAS#:650-52-2
CAS#:10294-34-5
CAS#:75-46-7
CAS#:360-56-5
CAS#:371-74-4
CAS#:432-02-0This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Chlorobis(trifluomethyl)arsine |
| bis(trifluoromethyl)arsinous chloride |
| Bis(trifluormethyl)-chlorarsan |
| Chlor-bis-trifluormethyl-arsin |
| chloro-bis-trifluoromethyl-arsine |
| Bis-trifluormethyl-arsinigsaeure-chlorid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 359-53-5? |
| A: Chinese name of 359-53-5 is 359-53-5. |
| Q: What English synonyms does chloro-bis(trifluoromethyl)arsane have? |
| A: English synonyms of chloro-bis(trifluoromethyl)arsane: Chlorobis(trifluomethyl)arsine, bis(trifluoromethyl)arsinous chloride, Bis(trifluormethyl)-chlorarsan, Chlor-bis-trifluormethyl-arsin, chloro-bis-trifluoromethyl-arsine, Bis-trifluormethyl-arsinigsaeure-chlorid. |
| Q: What is the SMILES notation of chloro-bis(trifluoromethyl)arsane? |
| A: SMILES notation of chloro-bis(trifluoromethyl)arsane is FC(F)(F)[As](Cl)C(F)(F)F. |
| Q: What is the InChIKey of chloro-bis(trifluoromethyl)arsane? |
| A: InChIKey of chloro-bis(trifluoromethyl)arsane is IPCCWPDCSYLYMS-UHFFFAOYSA-N. |
| Q: What is the molecular formula of chloro-bis(trifluoromethyl)arsane? |
| A: Molecular formula of chloro-bis(trifluoromethyl)arsane is C2AsClF6. |
| Q: What are the upstream materials of chloro-bis(trifluoromethyl)arsane? |
| A: Related upstream materials(CAS) of chloro-bis(trifluoromethyl)arsane: 7647-01-0;461-91-6;5185-67-1;650-52-2;10294-34-5. |
| Q: What is the English name of chloro-bis(trifluoromethyl)arsane? |
| A: The English name of chloro-bis(trifluoromethyl)arsane is chloro-bis(trifluoromethyl)arsane. |
| Q: What is the LogP of chloro-bis(trifluoromethyl)arsane? |
| A: LogP of chloro-bis(trifluoromethyl)arsane is 3.25950. |
| Q: What are the downstream products of chloro-bis(trifluoromethyl)arsane? |
| A: Related downstream products(CAS) of chloro-bis(trifluoromethyl)arsane: 75-46-7;360-56-5;371-74-4;432-02-0. |
| Q: What is the molecular weight of chloro-bis(trifluoromethyl)arsane? |
| A: Molecular weight of chloro-bis(trifluoromethyl)arsane is 248.38600. |