Feclemine structure
|
Common Name | Feclemine | ||
|---|---|---|---|---|
| CAS Number | 3590-16-7 | Molecular Weight | 358.60400 | |
| Density | 0.938g/cm3 | Boiling Point | 450.7ºC at 760 mmHg | |
| Molecular Formula | C24H42N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.9ºC | |
| Name | 2-[cyclohexyl(phenyl)methyl]-N,N,N',N'-tetraethylpropane-1,3-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.938g/cm3 |
|---|---|
| Boiling Point | 450.7ºC at 760 mmHg |
| Molecular Formula | C24H42N2 |
| Molecular Weight | 358.60400 |
| Flash Point | 197.9ºC |
| Exact Mass | 358.33500 |
| PSA | 6.48000 |
| LogP | 5.65030 |
| Index of Refraction | 1.515 |
| InChIKey | QDMORDTWFMWOFA-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC(CN(CC)CC)C(c1ccccc1)C1CCCCC1 |
| HS Code | 2921590090 |
|---|
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| tetra-N-ethyl-2-(cyclohexyl-phenyl-methyl)-propanediyldiamine |
| Spasmexan |
| Tetra-N-aethyl-2-(cyclohexyl-phenyl-methyl)-propandiyldiamin |
| Fecleminum [INN-Latin] |
| UNII-5P7U986QGO |
| Feclemina [INN-Spanish] |
| Fecleminum |
| Feclemina |
| Fenetamin |
| Feclemine |