4,4,4-TRIFLUORO-1-(2,5-DICHLOROPHENYL)-1,3-BUTANEDIONE structure
|
Common Name | 4,4,4-TRIFLUORO-1-(2,5-DICHLOROPHENYL)-1,3-BUTANEDIONE | ||
|---|---|---|---|---|
| CAS Number | 35981-64-7 | Molecular Weight | 285.04700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H5Cl2F3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2,5-Dichlorophenyl)-4,4,4-trifluorobutane-1,3-dione |
|---|
| Molecular Formula | C10H5Cl2F3O2 |
|---|---|
| Molecular Weight | 285.04700 |
| Exact Mass | 283.96200 |
| PSA | 34.14000 |
| LogP | 3.69760 |
| InChIKey | ASSCOENQJVQDRE-UHFFFAOYSA-N |
| SMILES | O=C(CC(=O)C(F)(F)F)c1cc(Cl)ccc1Cl |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |