Acetic acid,2,2'-[1,2-ethanediylbis(sulfonyl)]bis-, dimethyl ester (9CI) structure
|
Common Name | Acetic acid,2,2'-[1,2-ethanediylbis(sulfonyl)]bis-, dimethyl ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 35986-08-4 | Molecular Weight | 302.32200 | |
| Density | 1.442g/cm3 | Boiling Point | 563ºC at 760 mmHg | |
| Molecular Formula | C8H14O8S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 294.3ºC | |
| Name | methyl 2-[2-(2-methoxy-2-oxoethyl)sulfonylethylsulfonyl]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.442g/cm3 |
|---|---|
| Boiling Point | 563ºC at 760 mmHg |
| Molecular Formula | C8H14O8S2 |
| Molecular Weight | 302.32200 |
| Flash Point | 294.3ºC |
| Exact Mass | 302.01300 |
| PSA | 137.64000 |
| LogP | 0.32360 |
| Index of Refraction | 1.488 |
| InChIKey | PIMUOPGZUQUDFF-UHFFFAOYSA-N |
| SMILES | COC(=O)CS(=O)(=O)CCS(=O)(=O)CC(=O)OC |
| HS Code | 2917190090 |
|---|
|
~%
Acetic acid,2,2... CAS#:35986-08-4 |
| Literature: Baliah,V.; Prema,G. Indian Journal of Chemistry, 1971 , vol. 9, p. 1310 - 1311 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| dimethyl ethane-1,2-disulfonylacetate |
| Ethylen-bis-sulfonylessigsaeuremethylester |