(1S,2R,4S)-2-methyl-5-propan-2-ylcyclohex-5-ene-1,2,4-triol
Modify Date: 2026-07-11 20:43:36
(1S,2R,4S)-2-methyl-5-propan-2-ylcyclohex-5-ene-1,2,4-triol structure
|
Common Name | (1S,2R,4S)-2-methyl-5-propan-2-ylcyclohex-5-ene-1,2,4-triol | ||
|---|---|---|---|---|
| CAS Number | 359875-80-2 | Molecular Weight | 186.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (1S,2R,4S)-2-methyl-5-propan-2-ylcyclohex-5-ene-1,2,4-triol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H18O3 |
|---|---|
| Molecular Weight | 186.25 |
| InChIKey | SYRVWXFZYGDVTF-LPEHRKFASA-N |
| SMILES | CC(C)C1=CC(O)C(C)(O)CC1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of (1S,2R,4S)-2-methyl-5-propan-2-ylcyclohex-5-ene-1,2,4-triol? |
| A: Molecular weight of (1S,2R,4S)-2-methyl-5-propan-2-ylcyclohex-5-ene-1,2,4-triol is 186.25. |
| Q: What is the molecular formula of (1S,2R,4S)-2-methyl-5-propan-2-ylcyclohex-5-ene-1,2,4-triol? |
| A: Molecular formula of (1S,2R,4S)-2-methyl-5-propan-2-ylcyclohex-5-ene-1,2,4-triol is C10H18O3. |
| Q: What is the SMILES notation of (1S,2R,4S)-2-methyl-5-propan-2-ylcyclohex-5-ene-1,2,4-triol? |
| A: SMILES notation of (1S,2R,4S)-2-methyl-5-propan-2-ylcyclohex-5-ene-1,2,4-triol is CC(C)C1=CC(O)C(C)(O)CC1O. |
| Q: What is the English name of (1S,2R,4S)-2-methyl-5-propan-2-ylcyclohex-5-ene-1,2,4-triol? |
| A: The English name of (1S,2R,4S)-2-methyl-5-propan-2-ylcyclohex-5-ene-1,2,4-triol is (1S,2R,4S)-2-methyl-5-propan-2-ylcyclohex-5-ene-1,2,4-triol. |
| Q: What is the CAS number of (1S,2R,4S)-2-methyl-5-propan-2-ylcyclohex-5-ene-1,2,4-triol? |
| A: CAS number of (1S,2R,4S)-2-methyl-5-propan-2-ylcyclohex-5-ene-1,2,4-triol is 359875-80-2. |
| Q: What is the Chinese name of 359875-80-2? |
| A: Chinese name of 359875-80-2 is 359875-80-2. |
| Q: What is the InChIKey of (1S,2R,4S)-2-methyl-5-propan-2-ylcyclohex-5-ene-1,2,4-triol? |
| A: InChIKey of (1S,2R,4S)-2-methyl-5-propan-2-ylcyclohex-5-ene-1,2,4-triol is SYRVWXFZYGDVTF-LPEHRKFASA-N. |