2-(4-methoxyphenyl)-4-phenyl-6-(trichloromethyl)-1,3,5-triazine structure
|
Common Name | 2-(4-methoxyphenyl)-4-phenyl-6-(trichloromethyl)-1,3,5-triazine | ||
|---|---|---|---|---|
| CAS Number | 3599-82-4 | Molecular Weight | 380.65600 | |
| Density | 1.384g/cm3 | Boiling Point | 515.3ºC at 760 mmHg | |
| Molecular Formula | C17H12Cl3N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.5ºC | |
| Name | 2-(4-methoxyphenyl)-4-phenyl-6-(trichloromethyl)-1,3,5-triazine |
|---|
| Density | 1.384g/cm3 |
|---|---|
| Boiling Point | 515.3ºC at 760 mmHg |
| Molecular Formula | C17H12Cl3N3O |
| Molecular Weight | 380.65600 |
| Flash Point | 265.5ºC |
| Exact Mass | 379.00500 |
| PSA | 47.90000 |
| LogP | 5.04090 |
| Index of Refraction | 1.61 |
| InChIKey | ZCPQTUITJFEYKI-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2nc(-c3ccccc3)nc(C(Cl)(Cl)Cl)n2)cc1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |