(2-chloro-2,2-difluoroacetyl) 2-chloro-2,2-difluoroethaneperoxoate structure
|
Common Name | (2-chloro-2,2-difluoroacetyl) 2-chloro-2,2-difluoroethaneperoxoate | ||
|---|---|---|---|---|
| CAS Number | 360-42-9 | Molecular Weight | 258.94000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4Cl2F4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-chloro-2,2-difluoroacetyl) 2-chloro-2,2-difluoroethaneperoxoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C4Cl2F4O4 |
|---|---|
| Molecular Weight | 258.94000 |
| Exact Mass | 257.91100 |
| PSA | 52.60000 |
| LogP | 1.65100 |
| InChIKey | MYFJYYBCUDJENR-UHFFFAOYSA-N |
| SMILES | O=C(OOC(=O)C(F)(F)Cl)C(F)(F)Cl |
| HS Code | 2915900090 |
|---|
|
~36%
(2-chloro-2,2-d... CAS#:360-42-9 |
| Literature: Yoshida, Masato; Morinaga, Yoshihiro; Ueda, Masaaki; Kamigata, Nobumasa; Iyoda, Masahiko Chemistry Letters, 1992 , # 2 p. 227 - 230 |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| bis(chlorodifluoroacetyl) peroxide |
| Peroxide,bis(chlorodifluoroacetyl) |