3,3,4,4-tetrafluoro-2-(1,1,2,2,2-pentafluoroethyl)oxazetidine
3,3,4,4-tetrafluoro-2-(1,1,2,2,2-pentafluoroethyl)oxazetidine structure
|
Common Name | 3,3,4,4-tetrafluoro-2-(1,1,2,2,2-pentafluoroethyl)oxazetidine | ||
|---|---|---|---|---|
| CAS Number | 360-46-3 | Molecular Weight | 249.03500 | |
| Density | 1.8g/cm3 | Boiling Point | 4.8ºC at 760 mmHg | |
| Molecular Formula | C4F9NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,3,4,4-tetrafluoro-2-(1,1,2,2,2-pentafluoroethyl)oxazetidine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.8g/cm3 |
|---|---|
| Boiling Point | 4.8ºC at 760 mmHg |
| Molecular Formula | C4F9NO |
| Molecular Weight | 249.03500 |
| Exact Mass | 248.98400 |
| PSA | 12.47000 |
| LogP | 2.51220 |
| Index of Refraction | 1.292 |
| InChIKey | RXUSQTIPYBVRTK-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)N1OC(F)(F)C1(F)F |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:428-71-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3,3,4,4-tetrafluoro-2-pentafluoroethyl-[1,2]oxazetidine |
| 1,2-Oxazetidine,3,3,4,4-tetrafluoro-2-(pentafluoroethyl) |
| Perfluor-2-ethyl-1,2-oxazetidin |
| 2-Pentafluorethyl-3,3,4,4-tetrafluor-1,2-oxazetidin |
| perfluoro(2-ethyl-1,2-oxazetidine) |
| 3,3,4,4-Tetrafluor-2-pentafluorethyl-1,2-oxazetidin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 360-46-3? |
| A: Chinese name of 360-46-3 is 360-46-3. |
| Q: What is the English name of 3,3,4,4-tetrafluoro-2-(1,1,2,2,2-pentafluoroethyl)oxazetidine? |
| A: The English name of 3,3,4,4-tetrafluoro-2-(1,1,2,2,2-pentafluoroethyl)oxazetidine is 3,3,4,4-tetrafluoro-2-(1,1,2,2,2-pentafluoroethyl)oxazetidine. |
| Q: What is the CAS number of 3,3,4,4-tetrafluoro-2-(1,1,2,2,2-pentafluoroethyl)oxazetidine? |
| A: CAS number of 3,3,4,4-tetrafluoro-2-(1,1,2,2,2-pentafluoroethyl)oxazetidine is 360-46-3. |
| Q: What is the molecular formula of 3,3,4,4-tetrafluoro-2-(1,1,2,2,2-pentafluoroethyl)oxazetidine? |
| A: Molecular formula of 3,3,4,4-tetrafluoro-2-(1,1,2,2,2-pentafluoroethyl)oxazetidine is C4F9NO. |
| Q: What is the SMILES notation of 3,3,4,4-tetrafluoro-2-(1,1,2,2,2-pentafluoroethyl)oxazetidine? |
| A: SMILES notation of 3,3,4,4-tetrafluoro-2-(1,1,2,2,2-pentafluoroethyl)oxazetidine is FC(F)(F)C(F)(F)N1OC(F)(F)C1(F)F. |
| Q: What are the downstream products of 3,3,4,4-tetrafluoro-2-(1,1,2,2,2-pentafluoroethyl)oxazetidine? |
| A: Related downstream products(CAS) of 3,3,4,4-tetrafluoro-2-(1,1,2,2,2-pentafluoroethyl)oxazetidine: 428-71-7. |
| Q: What English synonyms does 3,3,4,4-tetrafluoro-2-(1,1,2,2,2-pentafluoroethyl)oxazetidine have? |
| A: English synonyms of 3,3,4,4-tetrafluoro-2-(1,1,2,2,2-pentafluoroethyl)oxazetidine: 3,3,4,4-tetrafluoro-2-pentafluoroethyl-[1,2]oxazetidine, 1,2-Oxazetidine,3,3,4,4-tetrafluoro-2-(pentafluoroethyl), Perfluor-2-ethyl-1,2-oxazetidin, 2-Pentafluorethyl-3,3,4,4-tetrafluor-1,2-oxazetidin, perfluoro(2-ethyl-1,2-oxazetidine), 3,3,4,4-Tetrafluor-2-pentafluorethyl-1,2-oxazetidin. |
| Q: What is the InChIKey of 3,3,4,4-tetrafluoro-2-(1,1,2,2,2-pentafluoroethyl)oxazetidine? |
| A: InChIKey of 3,3,4,4-tetrafluoro-2-(1,1,2,2,2-pentafluoroethyl)oxazetidine is RXUSQTIPYBVRTK-UHFFFAOYSA-N. |
| Q: What is the boiling point of 3,3,4,4-tetrafluoro-2-(1,1,2,2,2-pentafluoroethyl)oxazetidine? |
| A: Boiling point of 3,3,4,4-tetrafluoro-2-(1,1,2,2,2-pentafluoroethyl)oxazetidine is 4.8ºC at 760 mmHg. |
| Q: What is the LogP of 3,3,4,4-tetrafluoro-2-(1,1,2,2,2-pentafluoroethyl)oxazetidine? |
| A: LogP of 3,3,4,4-tetrafluoro-2-(1,1,2,2,2-pentafluoroethyl)oxazetidine is 2.51220. |