Cycloocta[b]quinoxaline, 6,7,8,9,10,11-hexahydro-, 5,12-dioxide structure
|
Common Name | Cycloocta[b]quinoxaline, 6,7,8,9,10,11-hexahydro-, 5,12-dioxide | ||
|---|---|---|---|---|
| CAS Number | 36003-05-1 | Molecular Weight | 244.28900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 12-oxido-6,7,8,9,10,11-hexahydrocycloocta[b]quinoxalin-5-ium 5-oxide |
|---|
| Molecular Formula | C14H16N2O2 |
|---|---|
| Molecular Weight | 244.28900 |
| Exact Mass | 244.12100 |
| PSA | 50.92000 |
| LogP | 3.35580 |
| InChIKey | WRXGMJUVZSEAPO-UHFFFAOYSA-N |
| SMILES | O=[n+]1c2c(n([O-])c3ccccc31)CCCCCC2 |
|
~0%
Cycloocta[b]qui... CAS#:36003-05-1 |
| Literature: Hahn, Witold E.; Lesiak, Jerzy Polish Journal of Chemistry, 1984 , vol. 58, # 7-8-9 p. 917 - 923 |
|
~%
Cycloocta[b]qui... CAS#:36003-05-1 |
| Literature: Hahn, Witold E.; Lesiak, Jerzy Polish Journal of Chemistry, 1984 , vol. 58, # 7-8-9 p. 917 - 923 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |