9,10-dioxoanthracene-2,6-disulfonyl chloride structure
|
Common Name | 9,10-dioxoanthracene-2,6-disulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 36003-87-9 | Molecular Weight | 405.23000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H6Cl2O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 9,10-dioxoanthracene-2,6-disulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H6Cl2O6S2 |
|---|---|
| Molecular Weight | 405.23000 |
| Exact Mass | 403.89800 |
| PSA | 119.18000 |
| LogP | 4.47860 |
| InChIKey | CZNYYPMFWGMKRC-UHFFFAOYSA-N |
| SMILES | O=C1c2ccc(S(=O)(=O)Cl)cc2C(=O)c2ccc(S(=O)(=O)Cl)cc21 |
|
~78%
9,10-dioxoanthr... CAS#:36003-87-9 |
| Literature: Armitage, Bruce; Yu, Changjun; Devadoss, Chelladurai; Schuster, Gary B. Journal of the American Chemical Society, 1994 , vol. 116, # 22 p. 9847 - 9859 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 9,10-Dioxo-9,10-dihydro-anthracen-2,6-disulfonylchlorid |
| 9,10-dioxo-9,10-dihydro-anthracene-2,6-disulfonyl chloride |
| 2,6-Anthracenedisulfonyl dichloride,9,10-dihydro-9,10-dioxo |
| 2,6-anthraquinonedisulfonyl chloride |
| 9,10-Dioxo-9,10-dihydro-2,6-anthracenedisulfonyl dichloride |
| anthraquinone-2,6-disulfonyl chloride |
| 9,10-Anthracenedione,2,6-bis(chlorosulfonyl) |
| 9,10-Dioxo-9,10-dihydro-anthracene-2,6-disulfonyl dichloride |
| Anthrachinon-disulfonsaeure-(2.6)-dichlorid |