9,10-dioxoanthracene-2,6-disulfonyl chloride
9,10-dioxoanthracene-2,6-disulfonyl chloride structure
|
Common Name | 9,10-dioxoanthracene-2,6-disulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 36003-87-9 | Molecular Weight | 405.23000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H6Cl2O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 9,10-dioxoanthracene-2,6-disulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H6Cl2O6S2 |
|---|---|
| Molecular Weight | 405.23000 |
| Exact Mass | 403.89800 |
| PSA | 119.18000 |
| LogP | 4.47860 |
| InChIKey | CZNYYPMFWGMKRC-UHFFFAOYSA-N |
| SMILES | O=C1c2ccc(S(=O)(=O)Cl)cc2C(=O)c2ccc(S(=O)(=O)Cl)cc21 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~78%
9,10-dioxoanthr... CAS#:36003-87-9 |
| Literature: Armitage, Bruce; Yu, Changjun; Devadoss, Chelladurai; Schuster, Gary B. Journal of the American Chemical Society, 1994 , vol. 116, # 22 p. 9847 - 9859 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 9,10-Dioxo-9,10-dihydro-anthracen-2,6-disulfonylchlorid |
| 9,10-dioxo-9,10-dihydro-anthracene-2,6-disulfonyl chloride |
| 2,6-Anthracenedisulfonyl dichloride,9,10-dihydro-9,10-dioxo |
| 2,6-anthraquinonedisulfonyl chloride |
| 9,10-Dioxo-9,10-dihydro-2,6-anthracenedisulfonyl dichloride |
| anthraquinone-2,6-disulfonyl chloride |
| 9,10-Anthracenedione,2,6-bis(chlorosulfonyl) |
| 9,10-Dioxo-9,10-dihydro-anthracene-2,6-disulfonyl dichloride |
| Anthrachinon-disulfonsaeure-(2.6)-dichlorid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 9,10-dioxoanthracene-2,6-disulfonyl chloride? |
| A: Related upstream materials(CAS) of 9,10-dioxoanthracene-2,6-disulfonyl chloride: 853-68-9. |
| Q: What is the CAS number of 9,10-dioxoanthracene-2,6-disulfonyl chloride? |
| A: CAS number of 9,10-dioxoanthracene-2,6-disulfonyl chloride is 36003-87-9. |
| Q: What is the English name of 9,10-dioxoanthracene-2,6-disulfonyl chloride? |
| A: The English name of 9,10-dioxoanthracene-2,6-disulfonyl chloride is 9,10-dioxoanthracene-2,6-disulfonyl chloride. |
| Q: What is the polar surface area (PSA) of 9,10-dioxoanthracene-2,6-disulfonyl chloride? |
| A: Polar surface area (PSA) of 9,10-dioxoanthracene-2,6-disulfonyl chloride is 119.18000. |
| Q: What is the molecular weight of 9,10-dioxoanthracene-2,6-disulfonyl chloride? |
| A: Molecular weight of 9,10-dioxoanthracene-2,6-disulfonyl chloride is 405.23000. |
| Q: What is the LogP of 9,10-dioxoanthracene-2,6-disulfonyl chloride? |
| A: LogP of 9,10-dioxoanthracene-2,6-disulfonyl chloride is 4.47860. |
| Q: What is the molecular formula of 9,10-dioxoanthracene-2,6-disulfonyl chloride? |
| A: Molecular formula of 9,10-dioxoanthracene-2,6-disulfonyl chloride is C14H6Cl2O6S2. |
| Q: What is the Chinese name of 36003-87-9? |
| A: Chinese name of 36003-87-9 is 36003-87-9. |
| Q: What is the InChIKey of 9,10-dioxoanthracene-2,6-disulfonyl chloride? |
| A: InChIKey of 9,10-dioxoanthracene-2,6-disulfonyl chloride is CZNYYPMFWGMKRC-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 9,10-dioxoanthracene-2,6-disulfonyl chloride? |
| A: SMILES notation of 9,10-dioxoanthracene-2,6-disulfonyl chloride is O=C1c2ccc(S(=O)(=O)Cl)cc2C(=O)c2ccc(S(=O)(=O)Cl)cc21. |