2-[1-(4-BROMOANILINO)ETHYLIDENE]MALONONITRILE structure
|
Common Name | 2-[1-(4-BROMOANILINO)ETHYLIDENE]MALONONITRILE | ||
|---|---|---|---|---|
| CAS Number | 360062-16-4 | Molecular Weight | 262.10500 | |
| Density | 1.532g/cm3 | Boiling Point | 362.4ºC at 760 mmHg | |
| Molecular Formula | C11H8BrN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173ºC | |
| Name | 2-[1-(4-bromoanilino)ethylidene]propanedinitrile |
|---|
| Density | 1.532g/cm3 |
|---|---|
| Boiling Point | 362.4ºC at 760 mmHg |
| Molecular Formula | C11H8BrN3 |
| Molecular Weight | 262.10500 |
| Flash Point | 173ºC |
| Exact Mass | 260.99000 |
| PSA | 59.61000 |
| LogP | 3.25516 |
| Index of Refraction | 1.64 |
| InChIKey | IKLPDQFWPDGHTL-UHFFFAOYSA-N |
| SMILES | CC(Nc1ccc(Br)cc1)=C(C#N)C#N |
| HS Code | 2926909090 |
|---|
|
~83%
2-[1-(4-BROMOAN... CAS#:360062-16-4 |
| Literature: Ryndina; Kadushkin; Solov'eva; Granik Chemistry of Heterocyclic Compounds, 2000 , vol. 36, # 12 p. 1409 - 1420 |
|
~%
2-[1-(4-BROMOAN... CAS#:360062-16-4 |
| Literature: Ryndina; Kadushkin; Solov'eva; Granik Chemistry of Heterocyclic Compounds, 2000 , vol. 36, # 12 p. 1409 - 1420 |
|
~%
2-[1-(4-BROMOAN... CAS#:360062-16-4 |
| Literature: Ryndina; Kadushkin; Solov'eva; Granik Chemistry of Heterocyclic Compounds, 2000 , vol. 36, # 12 p. 1409 - 1420 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |