2-[4-(p-Methoxyphenyl)-1-piperazinyl]pyrimidine structure
|
Common Name | 2-[4-(p-Methoxyphenyl)-1-piperazinyl]pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 3601-86-3 | Molecular Weight | 270.33000 | |
| Density | 1.188g/cm3 | Boiling Point | 481.7ºC at 760 mmHg | |
| Molecular Formula | C15H18N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.1ºC | |
| Name | 2-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.188g/cm3 |
|---|---|
| Boiling Point | 481.7ºC at 760 mmHg |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.33000 |
| Flash Point | 245.1ºC |
| Exact Mass | 270.14800 |
| PSA | 41.49000 |
| LogP | 1.94180 |
| Index of Refraction | 1.595 |
| InChIKey | MPBJZRJBGUVTBE-UHFFFAOYSA-N |
| SMILES | COc1ccc(N2CCN(c3ncccn3)CC2)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| hms2498b18 |