4-(3-METHOXYPHENYL)-4H-1,2,4-TRIAZOLE-3-THIOL structure
|
Common Name | 4-(3-METHOXYPHENYL)-4H-1,2,4-TRIAZOLE-3-THIOL | ||
|---|---|---|---|---|
| CAS Number | 36017-21-7 | Molecular Weight | 207.25200 | |
| Density | 1.33g/cm3 | Boiling Point | 320.9ºC at 760 mmHg | |
| Molecular Formula | C9H9N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.9ºC | |
| Name | 4-(3-methoxyphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 320.9ºC at 760 mmHg |
| Molecular Formula | C9H9N3OS |
| Molecular Weight | 207.25200 |
| Flash Point | 147.9ºC |
| Exact Mass | 207.04700 |
| PSA | 78.74000 |
| LogP | 1.56460 |
| Index of Refraction | 1.664 |
| InChIKey | KJCDYSNOKGTAPY-UHFFFAOYSA-N |
| SMILES | COc1cccc(-n2cn[nH]c2=S)c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(3-methoxyphenyl)-4H-1,2,4-triazole-3-thiol |
| 4-(3-methoxy-phenyl)-2,4-dihydro-[1,2,4]triazole-3-thione |
| HMS2688P04 |