2-Propenoicacid,2-methyl-3-[4-(1-methylethyl)phenyl]-(9CI) structure
|
Common Name | 2-Propenoicacid,2-methyl-3-[4-(1-methylethyl)phenyl]-(9CI) | ||
|---|---|---|---|---|
| CAS Number | 3602-26-4 | Molecular Weight | 204.26500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-3-(4-propan-2-ylphenyl)prop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H16O2 |
|---|---|
| Molecular Weight | 204.26500 |
| Exact Mass | 204.11500 |
| PSA | 37.30000 |
| LogP | 3.29790 |
| InChIKey | UOPMGDFNZIMWPC-UHFFFAOYSA-N |
| SMILES | CC(=Cc1ccc(C(C)C)cc1)C(=O)O |
| HS Code | 2916399090 |
|---|
|
~30%
2-Propenoicacid... CAS#:3602-26-4 |
| Literature: Wang, Zhi-Gang; Chen, Liqun; Chen, Jiebo; Zheng, Jian-Feng; Gao, Weiwei; Zeng, Zhiping; Zhou, Hu; Zhang, Xiao-Kun; Huang, Pei-Qiang; Su, Ying European Journal of Medicinal Chemistry, 2013 , vol. 62, p. 632 - 648 |
|
~%
2-Propenoicacid... CAS#:3602-26-4 |
| Literature: Gensler; Berman Journal of the American Chemical Society, 1958 , vol. 80, p. 4949,4952 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-METHYL-3-[4-(ISOPROPYL)PHENYL]-ACRYLIC ACID |
| Cinnamicacid,p-isopropyl-a-methyl-(6CI,7CI) |
| 2-Propenoic acid,2-methyl-3-[4-(1-methylethyl)phenyl] |
| 3-(4-Isopropyl-phenyl)-2-methyl-acrylsaeure |
| 3-(4-isopropyl-phenyl)-2-methyl-acrylic acid |