2-acetylxanthen-9-one structure
|
Common Name | 2-acetylxanthen-9-one | ||
|---|---|---|---|---|
| CAS Number | 36039-22-2 | Molecular Weight | 238.23800 | |
| Density | 1.287g/cm3 | Boiling Point | 418.633ºC at 760 mmHg | |
| Molecular Formula | C15H10O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.886ºC | |
| Name | 2-acetylxanthen-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.287g/cm3 |
|---|---|
| Boiling Point | 418.633ºC at 760 mmHg |
| Molecular Formula | C15H10O3 |
| Molecular Weight | 238.23800 |
| Flash Point | 188.886ºC |
| Exact Mass | 238.06300 |
| PSA | 47.28000 |
| LogP | 3.14880 |
| Index of Refraction | 1.626 |
| InChIKey | AFIDDEUBFNDBGR-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc2oc3ccccc3c(=O)c2c1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Acetylxanthon |
| 2-acetyl-9H-xanthen-9-one |
| 2-acetylxanthone |
| 2-acetyl-xanthen-9-one |
| HMS2205I08 |
| 9H-Xanthen-9-one,2-acetyl |