(1Z)-4-chloro-N-pyridin-1-ium-1-ylbenzenecarboximidate
Modify Date: 2025-11-25 21:20:38
(1Z)-4-chloro-N-pyridin-1-ium-1-ylbenzenecarboximidate structure
|
Common Name | (1Z)-4-chloro-N-pyridin-1-ium-1-ylbenzenecarboximidate | ||
|---|---|---|---|---|
| CAS Number | 36048-81-4 | Molecular Weight | 232.66600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (1Z)-4-chloro-N-pyridin-1-ium-1-ylbenzenecarboximidate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H9ClN2O |
|---|---|
| Molecular Weight | 232.66600 |
| Exact Mass | 232.04000 |
| PSA | 37.82000 |
| LogP | 3.29470 |
| InChIKey | SFANVOOYWJDMNE-UHFFFAOYSA-N |
| SMILES | [O-]C(=N[n+]1ccccc1)c1ccc(Cl)cc1 |
| HS Code | 2933399090 |
|---|
|
~36%
(1Z)-4-chloro-N... CAS#:36048-81-4 |
| Literature: Yeung; Corleto; Knaus Journal of Medicinal Chemistry, 1982 , vol. 25, # 6 p. 720 - 723 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (4-chloro-benzoyl)-pyridinium-1-yl-aminide |
| 1-(4-chloro-benzoylamino)-pyridinium betaine |
| Pyridinium,1-((4-chlorobenzoyl)amino)-,hydroxide,inner salt |