3-phenylmethoxy-1H-pyridazin-6-one structure
|
Common Name | 3-phenylmethoxy-1H-pyridazin-6-one | ||
|---|---|---|---|---|
| CAS Number | 3605-12-7 | Molecular Weight | 202.20900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-phenylmethoxy-1H-pyridazin-6-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H10N2O2 |
|---|---|
| Molecular Weight | 202.20900 |
| Exact Mass | 202.07400 |
| PSA | 55.24000 |
| LogP | 1.76120 |
| InChIKey | PTQPYHINVBWZPQ-UHFFFAOYSA-N |
| SMILES | O=c1ccc(OCc2ccccc2)n[nH]1 |
| HS Code | 2933990090 |
|---|
|
~91%
3-phenylmethoxy... CAS#:3605-12-7 |
| Literature: BOEHRINGER INGELHEIM INTERNATIONAL GMBH; BOEHRINGER INGELHEIM PHARMA GMBH and CO. KG Patent: WO2007/48802 A1, 2007 ; Location in patent: Page/Page column 79-80 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-benzyloxy-1,6H-pyridazin-6-one |
| 6-Benzyloxy-2H-pyridazinon-(3) |
| 6-(Benzyloxy)pyridazin-3(2H)-one |
| 3-Benzyloxy-pyridazinon-(6) |
| 6-(phenylmethoxy)-2-hydropyridazin-3-one |
| 6-Benzyloxy-3(2H)-pyridazinon |
| 6-benzyloxy-2H-pyridazin-3-one |
| 6-Benzyloxy-pyridazin-3(2H)-on |