1-(3-chloro-4-methylphenyl)-4-[2-[2-[4-(3-chloro-4-methylphenyl)piperazin-1-yl]ethylsulfonyl]ethyl]piperazine structure
|
Common Name | 1-(3-chloro-4-methylphenyl)-4-[2-[2-[4-(3-chloro-4-methylphenyl)piperazin-1-yl]ethylsulfonyl]ethyl]piperazine | ||
|---|---|---|---|---|
| CAS Number | 3606-02-8 | Molecular Weight | 539.56100 | |
| Density | 1.255g/cm3 | Boiling Point | 718ºC at 760 mmHg | |
| Molecular Formula | C26H36Cl2N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 388ºC | |
| Name | 1-(3-chloro-4-methylphenyl)-4-[2-[2-[4-(3-chloro-4-methylphenyl)piperazin-1-yl]ethylsulfonyl]ethyl]piperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.255g/cm3 |
|---|---|
| Boiling Point | 718ºC at 760 mmHg |
| Molecular Formula | C26H36Cl2N4O2S |
| Molecular Weight | 539.56100 |
| Flash Point | 388ºC |
| Exact Mass | 538.19400 |
| PSA | 55.48000 |
| LogP | 5.05580 |
| Index of Refraction | 1.596 |
| InChIKey | IDCKOEPWWZMSTH-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N2CCN(CCS(=O)(=O)CCN3CCN(c4ccc(C)c(Cl)c4)CC3)CC2)cc1Cl |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,1'-(sulfonyldiethane-2,1-diyl)bis[4-(3-chloro-4-methylphenyl)piperazine] |