Benzene,1-methoxy-5-methyl-2,4-dinitro- structure
|
Common Name | Benzene,1-methoxy-5-methyl-2,4-dinitro- | ||
|---|---|---|---|---|
| CAS Number | 3606-21-1 | Molecular Weight | 212.16000 | |
| Density | 1.383g/cm3 | Boiling Point | 374.7ºC at 760 mmHg | |
| Molecular Formula | C8H8N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.7ºC | |
| Name | 1-methoxy-5-methyl-2,4-dinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.383g/cm3 |
|---|---|
| Boiling Point | 374.7ºC at 760 mmHg |
| Molecular Formula | C8H8N2O5 |
| Molecular Weight | 212.16000 |
| Flash Point | 186.7ºC |
| Exact Mass | 212.04300 |
| PSA | 100.87000 |
| LogP | 2.86640 |
| Index of Refraction | 1.577 |
| InChIKey | XLPFUGPSJUAQSY-UHFFFAOYSA-N |
| SMILES | COc1cc(C)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| HS Code | 2909309090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Anisole,5-methyl-2,4-dinitro |
| 4.6-Dinitro-3-methoxy-toluol |
| 4,6-dinitro-3-methylanisole |
| 4,6-Dinitro-3-methoxytoluene |
| 2,4-Dinitro-5-methoxy-toluol |
| 5-Methyl-2,4-dinitro-anisol |
| 5-Methyl-2,4-dinitroanisole |
| 5-methoxy-2,4-dinitrotoluene |
| EINECS 222-769-3 |