pseudojervine structure
|
Common Name | pseudojervine | ||
|---|---|---|---|---|
| CAS Number | 36069-05-3 | Molecular Weight | 587.74400 | |
| Density | 1.1485 g/cm3 | Boiling Point | 643.44℃ at 760 mmHg | |
| Molecular Formula | C33H49NO8 | Melting Point | 300-301℃ | |
| MSDS | N/A | Flash Point | N/A | |
Use of pseudojervinePseudojervine is a glycoalkaloid with a feeble inhibition activity against platelet aggregation[1]. |
| Name | (3S,3'aS,7'aR,9R)-3',6',10,11b-tetramethyl-3-[(2R,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyspiro[1,2,3,4,6,6a,6b,7,8,11a-decahydrobenzo[a]fluorene-9,2'-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-b]pyridine]-11-one |
|---|---|
| Synonym | More Synonyms |
| Description | Pseudojervine is a glycoalkaloid with a feeble inhibition activity against platelet aggregation[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1485 g/cm3 |
|---|---|
| Boiling Point | 643.44℃ at 760 mmHg |
| Melting Point | 300-301℃ |
| Molecular Formula | C33H49NO8 |
| Molecular Weight | 587.74400 |
| Exact Mass | 587.34600 |
| PSA | 137.71000 |
| LogP | 2.33390 |
| InChIKey | HYDDDNUKNMMWBD-VPLHBGEQSA-N |
| SMILES | CC1=C2C(=O)C3C(CC=C4CC(OC5OC(CO)C(O)C(O)C5O)CCC43C)C2CCC12OC1CC(C)CNC1C2C |
| Pseudojervine |
| Jervin-3-glucoside |
| Pseudojervin |