2-[(3-Fluorobenzyl)oxy]benzoic acid structure
|
Common Name | 2-[(3-Fluorobenzyl)oxy]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 360778-48-9 | Molecular Weight | 246.23400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11FO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[(3-Fluorobenzyl)oxy]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H11FO3 |
|---|---|
| Molecular Weight | 246.23400 |
| Exact Mass | 246.06900 |
| PSA | 46.53000 |
| LogP | 3.10290 |
| InChIKey | YVCZMWYFCOWBIP-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1OCc1cccc(F)c1 |
| HS Code | 2918990090 |
|---|
|
~95%
2-[(3-Fluoroben... CAS#:360778-48-9 |
| Literature: KAKEN PHARMACEUTICAL CO., LTD. Patent: EP2168951 A1, 2010 ; Location in patent: Page/Page column 37; 62; 63 ; |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-(3-fluorobenzyloxy)benzoic acid |
| 2-(3-fluorobenzylamino)-ethanol |