3-[4-(4-methoxyphenyl)hexan-3-yl]pyridine
Modify Date: 2025-08-26 18:07:40
![3-[4-(4-methoxyphenyl)hexan-3-yl]pyridine Structure](https://image.chemsrc.com/caspic/403/3610-91-1.png)
3-[4-(4-methoxyphenyl)hexan-3-yl]pyridine structure
|
Common Name | 3-[4-(4-methoxyphenyl)hexan-3-yl]pyridine | ||
|---|---|---|---|---|
| CAS Number | 3610-91-1 | Molecular Weight | 269.38100 | |
| Density | 1.006g/cm3 | Boiling Point | 372.6ºC at 760 mmHg | |
| Molecular Formula | C18H23NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.7ºC | |
| Name | 3-[4-(4-methoxyphenyl)hexan-3-yl]pyridine |
|---|
| Density | 1.006g/cm3 |
|---|---|
| Boiling Point | 372.6ºC at 760 mmHg |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.38100 |
| Flash Point | 135.7ºC |
| Exact Mass | 269.17800 |
| PSA | 22.12000 |
| LogP | 4.77760 |
| Index of Refraction | 1.536 |
| InChIKey | XSGHXRWWLUGHFV-UHFFFAOYSA-N |
| SMILES | CCC(c1ccc(OC)cc1)C(CC)c1cccnc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |