1-benzofuran-2-yl-(4-nitrophenyl)methanol
Modify Date: 2025-09-13 07:28:11
1-benzofuran-2-yl-(4-nitrophenyl)methanol structure
|
Common Name | 1-benzofuran-2-yl-(4-nitrophenyl)methanol | ||
|---|---|---|---|---|
| CAS Number | 3611-66-3 | Molecular Weight | 269.25200 | |
| Density | 1.374g/cm3 | Boiling Point | 466.2ºC at 760 mmHg | |
| Molecular Formula | C15H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.7ºC | |
| Name | 1-benzofuran-2-yl-(4-nitrophenyl)methanol |
|---|
| Density | 1.374g/cm3 |
|---|---|
| Boiling Point | 466.2ºC at 760 mmHg |
| Molecular Formula | C15H11NO4 |
| Molecular Weight | 269.25200 |
| Flash Point | 235.7ºC |
| Exact Mass | 269.06900 |
| PSA | 79.19000 |
| LogP | 3.94590 |
| Index of Refraction | 1.677 |
| InChIKey | VPVXOXQYVCWECX-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(C(O)c2cc3ccccc3o2)cc1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |