Carbamothioic acid, dimethyl-,S-[4-(1-oxopropyl)phenyl] ester (9CI) structure
|
Common Name | Carbamothioic acid, dimethyl-,S-[4-(1-oxopropyl)phenyl] ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 36116-14-0 | Molecular Weight | 237.31800 | |
| Density | 1.16g/cm3 | Boiling Point | 370.2ºC at 760mmHg | |
| Molecular Formula | C12H15NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.7ºC | |
| Name | S-(4-propanoylphenyl) N,N-dimethylcarbamothioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 370.2ºC at 760mmHg |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.31800 |
| Flash Point | 177.7ºC |
| Exact Mass | 237.08200 |
| PSA | 62.68000 |
| LogP | 3.05300 |
| Index of Refraction | 1.57 |
| InChIKey | XKCLROTXTAYMNR-UHFFFAOYSA-N |
| SMILES | CCC(=O)c1ccc(SC(=O)N(C)C)cc1 |
|
~%
Carbamothioic a... CAS#:36116-14-0 |
| Literature: Rastogi; Anand; Prasad Journal of medicinal chemistry, 1972 , vol. 15, # 3 p. 286 - 291 |
|
~%
Carbamothioic a... CAS#:36116-14-0 |
| Literature: Rastogi; Anand; Prasad Journal of medicinal chemistry, 1972 , vol. 15, # 3 p. 286 - 291 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| S-p-Propionylphenyl-dimethylthiocarbamat |